C13H13Cl4N3O — CID 132531607
2,2,2-trichloro-N-[(4-chlorophenyl)-morpholin-4-ylmethylidene]ethanimidamide (PubChem CID 132531607) has the molecular formula C13H13Cl4N3O and a molecular weight of 369.08 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(4-chlorophenyl)-morpholin-4-ylmethylidene]ethanimidamide.
| Compound Name | 2,2,2-trichloro-N-[(4-chlorophenyl)-morpholin-4-ylmethylidene]ethanimidamide |
|---|---|
| PubChem CID | 132531607 |
| Molecular Formula | C13H13Cl4N3O |
| Molecular Weight | 369.08 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 2,2,2-trichloro-N-[(4-chlorophenyl)-morpholin-4-ylmethylidene]ethanimidamide |
| SMILES | [H]/N=C(/N=C(/c1ccc(Cl)cc1)N1CCOCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H13Cl4N3O/c14-10-3-1-9(2-4-10)11(19-12(18)13(15,16)17)20-5-7-21-8-6-20/h1-4,18H,5-8H2/b18-12+,19-11- |
| InChIKey | SSJWZJCLZGNDEE-WTSOWOPBSA-N |
| XLogP | 3.77 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.08 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|