C22H21NO4 — CID 132534426
benzyl 1-tert-butyl-2,5-dioxo-4-phenylpyrrole-3-carboxylate (PubChem CID 132534426) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is benzyl 1-tert-butyl-2,5-dioxo-4-phenylpyrrole-3-carboxylate.
| Compound Name | benzyl 1-tert-butyl-2,5-dioxo-4-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132534426 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | benzyl 1-tert-butyl-2,5-dioxo-4-phenylpyrrole-3-carboxylate |
| SMILES | CC(C)(C)N1C(=O)C(C(=O)OCc2ccccc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H21NO4/c1-22(2,3)23-19(24)17(16-12-8-5-9-13-16)18(20(23)25)21(26)27-14-15-10-6-4-7-11-15/h4-13H,14H2,1-3H3 |
| InChIKey | QDTXCJIZCMVDJY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|