C24H35NO4 — CID 132536489
tert-butyl (4aR,7R,7aR)-7a-hydroxy-1-methyl-2-oxo-7-[(2,4,6-trimethylphenyl)methyl]-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate (PubChem CID 132536489) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is tert-butyl (4aR,7R,7aR)-7a-hydroxy-1-methyl-2-oxo-7-[(2,4,6-trimethylphenyl)methyl]-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | tert-butyl (4aR,7R,7aR)-7a-hydroxy-1-methyl-2-oxo-7-[(2,4,6-trimethylphenyl)methyl]-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 132536489 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | tert-butyl (4aR,7R,7aR)-7a-hydroxy-1-methyl-2-oxo-7-[(2,4,6-trimethylphenyl)methyl]-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate |
| SMILES | Cc1cc(C)c(C[C@H]2CC[C@@]3(C(=O)OC(C)(C)C)CCC(=O)N(C)[C@@]23O)c(C)c1 |
| InChI | InChI=1S/C24H35NO4/c1-15-12-16(2)19(17(3)13-15)14-18-8-10-23(21(27)29-22(4,5)6)11-9-20(26)25(7)24(18,23)28/h12-13,18,28H,8-11,14H2,1-7H3/t18-,23+,24-/m1/s1 |
| InChIKey | YHBMJJBWNIWRJV-PUZWTLIVSA-N |
| XLogP | 3.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |