C21H29NO4 — CID 132536492
tert-butyl (4aS,7S,7aS)-7-benzyl-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate (PubChem CID 132536492) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl (4aS,7S,7aS)-7-benzyl-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | tert-butyl (4aS,7S,7aS)-7-benzyl-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 132536492 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl (4aS,7S,7aS)-7-benzyl-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate |
| SMILES | CN1C(=O)CC[C@@]2(C(=O)OC(C)(C)C)CC[C@@H](Cc3ccccc3)[C@@]12O |
| InChI | InChI=1S/C21H29NO4/c1-19(2,3)26-18(24)20-12-10-16(14-15-8-6-5-7-9-15)21(20,25)22(4)17(23)11-13-20/h5-9,16,25H,10-14H2,1-4H3/t16-,20+,21-/m0/s1 |
| InChIKey | NLUPIJFQQJQRDH-DQLDELGASA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |