C18H24N2O4S — CID 46184742
tert-butyl 2-benzylsulfanyl-1,4-dimethyl-3,6-dioxopiperazine-2-carboxylate (PubChem CID 46184742) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is tert-butyl 2-benzylsulfanyl-1,4-dimethyl-3,6-dioxopiperazine-2-carboxylate.
| Compound Name | tert-butyl 2-benzylsulfanyl-1,4-dimethyl-3,6-dioxopiperazine-2-carboxylate |
|---|---|
| PubChem CID | 46184742 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | tert-butyl 2-benzylsulfanyl-1,4-dimethyl-3,6-dioxopiperazine-2-carboxylate |
| SMILES | CN1CC(=O)N(C)C(SCc2ccccc2)(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C18H24N2O4S/c1-17(2,3)24-16(23)18(25-12-13-9-7-6-8-10-13)15(22)19(4)11-14(21)20(18)5/h6-10H,11-12H2,1-5H3 |
| InChIKey | FHDMMCXYHTYUIZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|