C32H31N — CID 132538765
N-[(E)-3-(4-tert-butylphenyl)-3-phenylprop-1-enyl]-1,1-diphenylmethanimine (PubChem CID 132538765) has the molecular formula C32H31N and a molecular weight of 429.61 g/mol. Its IUPAC name is N-[(E)-3-(4-tert-butylphenyl)-3-phenylprop-1-enyl]-1,1-diphenylmethanimine.
| Compound Name | N-[(E)-3-(4-tert-butylphenyl)-3-phenylprop-1-enyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 132538765 |
| Molecular Formula | C32H31N |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-[(E)-3-(4-tert-butylphenyl)-3-phenylprop-1-enyl]-1,1-diphenylmethanimine |
| SMILES | CC(C)(C)c1ccc(C(/C=C/N=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H31N/c1-32(2,3)29-21-19-26(20-22-29)30(25-13-7-4-8-14-25)23-24-33-31(27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-24,30H,1-3H3/b24-23+ |
| InChIKey | BDXFGYBCCLXMEJ-WCWDXBQESA-N |
| XLogP | 8.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|