C10H15NO — CID 132539025
7,7-dimethyl-2,3,6,8-tetrahydroindolizin-5-one (PubChem CID 132539025) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 7,7-dimethyl-2,3,6,8-tetrahydroindolizin-5-one.
| Compound Name | 7,7-dimethyl-2,3,6,8-tetrahydroindolizin-5-one |
|---|---|
| PubChem CID | 132539025 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 7,7-dimethyl-2,3,6,8-tetrahydroindolizin-5-one |
| SMILES | CC1(C)CC(=O)N2CCC=C2C1 |
| InChI | InChI=1S/C10H15NO/c1-10(2)6-8-4-3-5-11(8)9(12)7-10/h4H,3,5-7H2,1-2H3 |
| InChIKey | ZBVXKHAVGXWIKF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |