C21H20O5 — CID 132539283
ethyl 1-hydroxy-5,7-dimethoxy-3-phenylnaphthalene-2-carboxylate (PubChem CID 132539283) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 1-hydroxy-5,7-dimethoxy-3-phenylnaphthalene-2-carboxylate.
| Compound Name | ethyl 1-hydroxy-5,7-dimethoxy-3-phenylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 132539283 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl 1-hydroxy-5,7-dimethoxy-3-phenylnaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)cc2c(OC)cc(OC)cc2c1O |
| InChI | InChI=1S/C21H20O5/c1-4-26-21(23)19-15(13-8-6-5-7-9-13)12-16-17(20(19)22)10-14(24-2)11-18(16)25-3/h5-12,22H,4H2,1-3H3 |
| InChIKey | PYRXUDCVDFMTEV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |