C21H24O6 — CID 132539447
diethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 132539447) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is diethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | diethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132539447 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | diethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2C=C(C)OC(=O)[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24O6/c1-4-25-19(23)21(20(24)26-5-2)12-15-11-13(3)27-18(22)16(15)17(21)14-9-7-6-8-10-14/h6-11,15-17H,4-5,12H2,1-3H3/t15-,16-,17+/m1/s1 |
| InChIKey | MLVMGSBZOMMCHM-ZACQAIPSSA-N |
| XLogP | 2.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|