C23H28O6 — CID 132539450
dipropan-2-yl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 132539450) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is dipropan-2-yl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dipropan-2-yl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132539450 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | dipropan-2-yl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | CC1=C[C@@H]2CC(C(=O)OC(C)C)(C(=O)OC(C)C)[C@@H](c3ccccc3)[C@@H]2C(=O)O1 |
| InChI | InChI=1S/C23H28O6/c1-13(2)27-21(25)23(22(26)28-14(3)4)12-17-11-15(5)29-20(24)18(17)19(23)16-9-7-6-8-10-16/h6-11,13-14,17-19H,12H2,1-5H3/t17-,18-,19+/m1/s1 |
| InChIKey | DCHUXDPGJWESIB-QRVBRYPASA-N |
| XLogP | 3.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|