C26H26O6 — CID 132539451
dibenzyl (4aS,7S,7aR)-3,7-dimethyl-1-oxo-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 132539451) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is dibenzyl (4aS,7S,7aR)-3,7-dimethyl-1-oxo-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dibenzyl (4aS,7S,7aR)-3,7-dimethyl-1-oxo-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132539451 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | dibenzyl (4aS,7S,7aR)-3,7-dimethyl-1-oxo-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | CC1=C[C@@H]2CC(C(=O)OCc3ccccc3)(C(=O)OCc3ccccc3)[C@@H](C)[C@@H]2C(=O)O1 |
| InChI | InChI=1S/C26H26O6/c1-17-13-21-14-26(18(2)22(21)23(27)32-17,24(28)30-15-19-9-5-3-6-10-19)25(29)31-16-20-11-7-4-8-12-20/h3-13,18,21-22H,14-16H2,1-2H3/t18-,21+,22-/m0/s1 |
| InChIKey | NUPICUGAHPGZGX-BWAGFHJFSA-N |
| XLogP | 4.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|