C24H22O6 — CID 132539454
dimethyl (4aS,7R,7aR)-1-oxo-3,7-diphenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 132539454) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is dimethyl (4aS,7R,7aR)-1-oxo-3,7-diphenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dimethyl (4aS,7R,7aR)-1-oxo-3,7-diphenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132539454 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | dimethyl (4aS,7R,7aR)-1-oxo-3,7-diphenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2C=C(c3ccccc3)OC(=O)[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22O6/c1-28-22(26)24(23(27)29-2)14-17-13-18(15-9-5-3-6-10-15)30-21(25)19(17)20(24)16-11-7-4-8-12-16/h3-13,17,19-20H,14H2,1-2H3/t17-,19-,20+/m1/s1 |
| InChIKey | GGMRCMZXDGETKU-RLLQIKCJSA-N |
| XLogP | 3.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|