C25H29NO2 — CID 132539906
1-(3-methoxyphenyl)-2-phenyl-3-(2,4,6-trimethylanilino)propan-1-ol (PubChem CID 132539906) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-phenyl-3-(2,4,6-trimethylanilino)propan-1-ol.
| Compound Name | 1-(3-methoxyphenyl)-2-phenyl-3-(2,4,6-trimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 132539906 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-phenyl-3-(2,4,6-trimethylanilino)propan-1-ol |
| SMILES | COc1cccc(C(O)C(CNc2c(C)cc(C)cc2C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H29NO2/c1-17-13-18(2)24(19(3)14-17)26-16-23(20-9-6-5-7-10-20)25(27)21-11-8-12-22(15-21)28-4/h5-15,23,25-27H,16H2,1-4H3 |
| InChIKey | UIAJJYIHNBUAGA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |