C22H19ClO3 — CID 132540432
9-(3-chlorophenyl)-1,2,3-trimethoxy-9H-fluorene (PubChem CID 132540432) has the molecular formula C22H19ClO3 and a molecular weight of 366.84 g/mol. Its IUPAC name is 9-(3-chlorophenyl)-1,2,3-trimethoxy-9H-fluorene.
| Compound Name | 9-(3-chlorophenyl)-1,2,3-trimethoxy-9H-fluorene |
|---|---|
| PubChem CID | 132540432 |
| Molecular Formula | C22H19ClO3 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 9-(3-chlorophenyl)-1,2,3-trimethoxy-9H-fluorene |
| SMILES | COc1cc2c(c(OC)c1OC)C(c1cccc(Cl)c1)c1ccccc1-2 |
| InChI | InChI=1S/C22H19ClO3/c1-24-18-12-17-15-9-4-5-10-16(15)19(13-7-6-8-14(23)11-13)20(17)22(26-3)21(18)25-2/h4-12,19H,1-3H3 |
| InChIKey | VDOQGVINNMWEPW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |