About dipotassium;4-(4-oxidophenyl)sulfanylphenolate
dipotassium;4-(4-oxidophenyl)sulfanylphenolate (PubChem CID 132541568) has the molecular formula C12H8K2O2S
and a molecular weight of 294.46 g/mol. Its IUPAC name is dipotassium;4-(4-oxidophenyl)sulfanylphenolate.
Molecular Properties
| Compound Name | dipotassium;4-(4-oxidophenyl)sulfanylphenolate |
| PubChem CID | 132541568 |
| Molecular Formula | C12H8K2O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | dipotassium;4-(4-oxidophenyl)sulfanylphenolate |
| SMILES | [K+].[K+].[O-]c1ccc(Sc2ccc([O-])cc2)cc1 |
| InChI | InChI=1S/C12H10O2S.2K/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;;/h1-8,13-14H;;/q;2*+1/p-2 |
| InChIKey | PMJXPQKUOMELOH-UHFFFAOYSA-L |
| XLogP | -4.01 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dipotassium;4-(4-oxidophenyl)sulfanylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;4-(4-oxidophenyl)sulfanylphenolate?
The IUPAC name of dipotassium;4-(4-oxidophenyl)sulfanylphenolate (CID 132541568) is dipotassium;4-(4-oxidophenyl)sulfanylphenolate.
What is the SMILES notation for dipotassium;4-(4-oxidophenyl)sulfanylphenolate?
The canonical SMILES for dipotassium;4-(4-oxidophenyl)sulfanylphenolate is [K+].[K+].[O-]c1ccc(Sc2ccc([O-])cc2)cc1.
What is the InChIKey of dipotassium;4-(4-oxidophenyl)sulfanylphenolate?
The InChIKey is PMJXPQKUOMELOH-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H10O2S.2K/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;;/h1-8,13-14H;;/q;2*+1/p-2.
What are the key properties of dipotassium;4-(4-oxidophenyl)sulfanylphenolate?
dipotassium;4-(4-oxidophenyl)sulfanylphenolate has a molecular weight of 294.46 g/mol, XLogP of -4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;4-(4-oxidophenyl)sulfanylphenolate is sourced from PubChem (CID 132541568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).