C24H36F3NO3P+ — CID 132541801
[2-[benzoyl(methyl)amino]-4,4,4-trifluoro-3-oxobutanoyl]-tributylphosphanium (PubChem CID 132541801) has the molecular formula C24H36F3NO3P+ and a molecular weight of 474.52 g/mol. Its IUPAC name is [2-[benzoyl(methyl)amino]-4,4,4-trifluoro-3-oxobutanoyl]-tributylphosphanium.
| Compound Name | [2-[benzoyl(methyl)amino]-4,4,4-trifluoro-3-oxobutanoyl]-tributylphosphanium |
|---|---|
| PubChem CID | 132541801 |
| Molecular Formula | C24H36F3NO3P+ |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [2-[benzoyl(methyl)amino]-4,4,4-trifluoro-3-oxobutanoyl]-tributylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)C(=O)C(C(=O)C(F)(F)F)N(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H36F3NO3P/c1-5-8-16-32(17-9-6-2,18-10-7-3)23(31)20(21(29)24(25,26)27)28(4)22(30)19-14-12-11-13-15-19/h11-15,20H,5-10,16-18H2,1-4H3/q+1 |
| InChIKey | JGGJLMKQSKBOOO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|