About methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate
methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate (PubChem CID 132542456) has the molecular formula C25H25ClN2O4
and a molecular weight of 452.94 g/mol. Its IUPAC name is methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate |
| PubChem CID | 132542456 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate |
| SMILES | COC(=O)C1(c2cccc(Cl)c2)CN(c2ccc(OC)cc2)CN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H25ClN2O4/c1-30-22-11-7-20(8-12-22)27-16-25(24(29)32-3,18-5-4-6-19(26)15-18)28(17-27)21-9-13-23(31-2)14-10-21/h4-15H,16-17H2,1-3H3 |
| InChIKey | QDPOYCHRFXGSNO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate?
The IUPAC name of methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate (CID 132542456) is methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate.
What is the SMILES notation for methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate?
The canonical SMILES for methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate is COC(=O)C1(c2cccc(Cl)c2)CN(c2ccc(OC)cc2)CN1c1ccc(OC)cc1.
What is the InChIKey of methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate?
The InChIKey is QDPOYCHRFXGSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25ClN2O4/c1-30-22-11-7-20(8-12-22)27-16-25(24(29)32-3,18-5-4-6-19(26)15-18)28(17-27)21-9-13-23(31-2)14-10-21/h4-15H,16-17H2,1-3H3.
What are the key properties of methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate?
methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate has a molecular weight of 452.94 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-chlorophenyl)-1,3-bis(4-methoxyphenyl)imidazolidine-4-carboxylate is sourced from PubChem (CID 132542456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).