C31H34O8 — CID 132544756
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl 6-oxo-3,4,6-triphenylhexanoate (PubChem CID 132544756) has the molecular formula C31H34O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl 6-oxo-3,4,6-triphenylhexanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl 6-oxo-3,4,6-triphenylhexanoate |
|---|---|
| PubChem CID | 132544756 |
| Molecular Formula | C31H34O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl 6-oxo-3,4,6-triphenylhexanoate |
| SMILES | CO[C@@H]1O[C@H](COC(=O)CC(c2ccccc2)C(CC(=O)c2ccccc2)c2ccccc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H34O8/c1-37-31-30(36)29(35)28(34)26(39-31)19-38-27(33)18-24(21-13-7-3-8-14-21)23(20-11-5-2-6-12-20)17-25(32)22-15-9-4-10-16-22/h2-16,23-24,26,28-31,34-36H,17-19H2,1H3/t23?,24?,26-,28-,29+,30-,31-/m1/s1 |
| InChIKey | IZYUCPOWSVFTAP-ZLFMCCOSSA-N |
| XLogP | 3.21 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |