C24H19NO4S — CID 132546748
(2S)-2-(furan-2-yl)-9-(4-methylphenyl)sulfonyl-1,2-dihydrocarbazole-3-carbaldehyde (PubChem CID 132546748) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-9-(4-methylphenyl)sulfonyl-1,2-dihydrocarbazole-3-carbaldehyde.
| Compound Name | (2S)-2-(furan-2-yl)-9-(4-methylphenyl)sulfonyl-1,2-dihydrocarbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 132546748 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (2S)-2-(furan-2-yl)-9-(4-methylphenyl)sulfonyl-1,2-dihydrocarbazole-3-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)C=C(C=O)[C@@H](c2ccco2)C3)cc1 |
| InChI | InChI=1S/C24H19NO4S/c1-16-8-10-18(11-9-16)30(27,28)25-22-6-3-2-5-19(22)21-13-17(15-26)20(14-23(21)25)24-7-4-12-29-24/h2-13,15,20H,14H2,1H3/t20-/m0/s1 |
| InChIKey | HQFGRZMJUFFNSX-FQEVSTJZSA-N |
| XLogP | 4.70 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|