C15H13F3N2O — CID 132546841
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(2-methylphenyl)but-3-yn-2-ol (PubChem CID 132546841) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(2-methylphenyl)but-3-yn-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(2-methylphenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 132546841 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(2-methylphenyl)but-3-yn-2-ol |
| SMILES | Cc1ccccc1C#CC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O/c1-11-5-3-4-6-12(11)7-8-14(21,15(16,17)18)13-19-9-10-20(13)2/h3-6,9-10,21H,1-2H3 |
| InChIKey | OFNKMZHNGDARRA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|