C20H15F3N2O — CID 132546844
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(4-phenylphenyl)but-3-yn-2-ol (PubChem CID 132546844) has the molecular formula C20H15F3N2O and a molecular weight of 356.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(4-phenylphenyl)but-3-yn-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(4-phenylphenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 132546844 |
| Molecular Formula | C20H15F3N2O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-(4-phenylphenyl)but-3-yn-2-ol |
| SMILES | Cn1ccnc1C(O)(C#Cc1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H15F3N2O/c1-25-14-13-24-18(25)19(26,20(21,22)23)12-11-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h2-10,13-14,26H,1H3 |
| InChIKey | YIKIIQMVFCTTKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|