C31H31BFN3O4 — CID 132550418
[5-(dibutylamino)-17-fluoro-8,18-dioxa-15-aza-16-azonia-17-boranuidapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15-nonaen-17-yl] benzoate (PubChem CID 132550418) has the molecular formula C31H31BFN3O4 and a molecular weight of 539.42 g/mol. Its IUPAC name is [5-(dibutylamino)-17-fluoro-8,18-dioxa-15-aza-16-azonia-17-boranuidapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15-nonaen-17-yl] benzoate.
| Compound Name | [5-(dibutylamino)-17-fluoro-8,18-dioxa-15-aza-16-azonia-17-boranuidapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15-nonaen-17-yl] benzoate |
|---|---|
| PubChem CID | 132550418 |
| Molecular Formula | C31H31BFN3O4 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | [5-(dibutylamino)-17-fluoro-8,18-dioxa-15-aza-16-azonia-17-boranuidapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15-nonaen-17-yl] benzoate |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cccc3c4c(cc-2c13)O[B-](F)(OC(=O)c1ccccc1)[NH+]=N4 |
| InChI | InChI=1S/C31H31BFN3O4/c1-3-5-17-36(18-6-4-2)22-15-16-23-25-20-28-30(24-13-10-14-26(29(24)25)38-27(23)19-22)34-35-32(33,39-28)40-31(37)21-11-8-7-9-12-21/h7-16,19-20,35H,3-6,17-18H2,1-2H3 |
| InChIKey | AKQAVHLOOKNJJP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|