C20H25NO2 — CID 132553078
(1R,2E,4R,9R,10E,12Z,14S,17R,19S,20R)-19-hydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one (PubChem CID 132553078) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (1R,2E,4R,9R,10E,12Z,14S,17R,19S,20R)-19-hydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one.
| Compound Name | (1R,2E,4R,9R,10E,12Z,14S,17R,19S,20R)-19-hydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
|---|---|
| PubChem CID | 132553078 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (1R,2E,4R,9R,10E,12Z,14S,17R,19S,20R)-19-hydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
| SMILES | C[C@@H]1C[C@H](O)[C@H]2[C@@H]3/C=C/[C@H]4C=CCC[C@@H]4/C=C/C=C\[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C20H25NO2/c1-13-12-18(22)19-16-11-10-15-8-3-2-6-14(15)7-4-5-9-17(16)20(23)21(13)19/h3-5,7-11,13-19,22H,2,6,12H2,1H3/b7-4+,9-5-,11-10+/t13-,14-,15-,16-,17+,18+,19-/m1/s1 |
| InChIKey | RIBNBKRJTMJARF-FDLOFISESA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|