C29H39NO4 — CID 162863083
(1S,4R,7R,8S,9S,10E,14S,17R,19S,20R)-7,8,19-trihydroxy-2,10-dimethyl-17-octa-2,4-dienyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one (PubChem CID 162863083) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is (1S,4R,7R,8S,9S,10E,14S,17R,19S,20R)-7,8,19-trihydroxy-2,10-dimethyl-17-octa-2,4-dienyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one.
| Compound Name | (1S,4R,7R,8S,9S,10E,14S,17R,19S,20R)-7,8,19-trihydroxy-2,10-dimethyl-17-octa-2,4-dienyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
|---|---|
| PubChem CID | 162863083 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (1S,4R,7R,8S,9S,10E,14S,17R,19S,20R)-7,8,19-trihydroxy-2,10-dimethyl-17-octa-2,4-dienyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
| SMILES | CCCC=CC=CC[C@@H]1C[C@H](O)[C@H]2[C@@H]3C(C)=C[C@H]4C=C[C@@H](O)[C@@H](O)[C@@H]4/C(C)=C/C=C[C@@H]3C(=O)N12 |
| InChI | InChI=1S/C29H39NO4/c1-4-5-6-7-8-9-12-21-17-24(32)27-26-19(3)16-20-14-15-23(31)28(33)25(20)18(2)11-10-13-22(26)29(34)30(21)27/h6-11,13-16,20-28,31-33H,4-5,12,17H2,1-3H3/b7-6?,9-8?,13-10?,18-11+,19-16?/t20-,21-,22+,23-,24+,25-,26-,27+,28-/m1/s1 |
| InChIKey | APYNVIXJDXCVNV-MLOHZCOMSA-N |
| XLogP | 3.85 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|