C20H25NO4 — CID 132553080
(1R,2E,4R,7R,8S,9R,10E,12Z,14S,17R,19S,20R)-7,8,19-trihydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one (PubChem CID 132553080) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (1R,2E,4R,7R,8S,9R,10E,12Z,14S,17R,19S,20R)-7,8,19-trihydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one.
| Compound Name | (1R,2E,4R,7R,8S,9R,10E,12Z,14S,17R,19S,20R)-7,8,19-trihydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
|---|---|
| PubChem CID | 132553080 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1R,2E,4R,7R,8S,9R,10E,12Z,14S,17R,19S,20R)-7,8,19-trihydroxy-17-methyl-16-azatetracyclo[12.6.0.04,9.016,20]icosa-2,5,10,12-tetraen-15-one |
| SMILES | C[C@@H]1C[C@H](O)[C@H]2[C@@H]3/C=C/[C@@H]4C=C[C@@H](O)[C@@H](O)[C@@H]4/C=C/C=C\[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C20H25NO4/c1-11-10-17(23)18-14-8-6-12-7-9-16(22)19(24)13(12)4-2-3-5-15(14)20(25)21(11)18/h2-9,11-19,22-24H,10H2,1H3/b4-2+,5-3-,8-6+/t11-,12-,13-,14-,15+,16-,17+,18-,19+/m1/s1 |
| InChIKey | AZMQDAPJQMFEBV-VIOXFOIRSA-N |
| XLogP | 0.79 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|