C21H27NO3S — CID 132553156
(1S,6S)-6-(cyclopenten-1-yl)-1-methyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.2.1]nonan-7-one (PubChem CID 132553156) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is (1S,6S)-6-(cyclopenten-1-yl)-1-methyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.2.1]nonan-7-one.
| Compound Name | (1S,6S)-6-(cyclopenten-1-yl)-1-methyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.2.1]nonan-7-one |
|---|---|
| PubChem CID | 132553156 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (1S,6S)-6-(cyclopenten-1-yl)-1-methyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.2.1]nonan-7-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@]3(C4=CCCC4)C[C@@](C)(CC3=O)C2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-16-7-9-18(10-8-16)26(24,25)22-12-11-21(17-5-3-4-6-17)14-20(2,15-22)13-19(21)23/h5,7-10H,3-4,6,11-15H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | YIVSPUOHPZBLDM-NHCUHLMSSA-N |
| XLogP | 3.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|