C22H22N4OS — CID 132553382
[2-anilino-4-(2-cyclohexylidenehydrazinyl)-1,3-thiazol-5-yl]-phenylmethanone (PubChem CID 132553382) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is [2-anilino-4-(2-cyclohexylidenehydrazinyl)-1,3-thiazol-5-yl]-phenylmethanone.
| Compound Name | [2-anilino-4-(2-cyclohexylidenehydrazinyl)-1,3-thiazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 132553382 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-anilino-4-(2-cyclohexylidenehydrazinyl)-1,3-thiazol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1sc(Nc2ccccc2)nc1NN=C1CCCCC1 |
| InChI | InChI=1S/C22H22N4OS/c27-19(16-10-4-1-5-11-16)20-21(26-25-18-14-8-3-9-15-18)24-22(28-20)23-17-12-6-2-7-13-17/h1-2,4-7,10-13,26H,3,8-9,14-15H2,(H,23,24) |
| InChIKey | IUPDKVJPAQGMDI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|