C15H11BrN2O3S2 — CID 132555315
3-[(2-bromophenyl)methyl]-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione (PubChem CID 132555315) has the molecular formula C15H11BrN2O3S2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methyl]-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione.
| Compound Name | 3-[(2-bromophenyl)methyl]-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione |
|---|---|
| PubChem CID | 132555315 |
| Molecular Formula | C15H11BrN2O3S2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | 3-[(2-bromophenyl)methyl]-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(O)N(Cc1ccccc1Br)C(=S)S2 |
| InChI | InChI=1S/C15H11BrN2O3S2/c16-12-4-2-1-3-9(12)8-17-14(19)11-7-10(18(20)21)5-6-13(11)23-15(17)22/h1-7,14,19H,8H2 |
| InChIKey | PPRZPZNIQMGUEY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|