C12H14N2O3S2 — CID 132555316
3-butyl-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione (PubChem CID 132555316) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-butyl-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione.
| Compound Name | 3-butyl-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione |
|---|---|
| PubChem CID | 132555316 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-butyl-4-hydroxy-6-nitro-4H-1,3-benzothiazine-2-thione |
| SMILES | CCCCN1C(=S)Sc2ccc([N+](=O)[O-])cc2C1O |
| InChI | InChI=1S/C12H14N2O3S2/c1-2-3-6-13-11(15)9-7-8(14(16)17)4-5-10(9)19-12(13)18/h4-5,7,11,15H,2-3,6H2,1H3 |
| InChIKey | TZFUNRLWBWVLIE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|