C15H9ClN4O3S — CID 126279189
(9R)-2-(3-chlorophenyl)-7-nitro-9H-[1,2,4]triazolo[5,1-b][1,3]benzothiazin-9-ol (PubChem CID 126279189) has the molecular formula C15H9ClN4O3S and a molecular weight of 360.78 g/mol. Its IUPAC name is (9R)-2-(3-chlorophenyl)-7-nitro-9H-[1,2,4]triazolo[5,1-b][1,3]benzothiazin-9-ol.
| Compound Name | (9R)-2-(3-chlorophenyl)-7-nitro-9H-[1,2,4]triazolo[5,1-b][1,3]benzothiazin-9-ol |
|---|---|
| PubChem CID | 126279189 |
| Molecular Formula | C15H9ClN4O3S |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (9R)-2-(3-chlorophenyl)-7-nitro-9H-[1,2,4]triazolo[5,1-b][1,3]benzothiazin-9-ol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H](O)n1nc(-c3cccc(Cl)c3)nc1S2 |
| InChI | InChI=1S/C15H9ClN4O3S/c16-9-3-1-2-8(6-9)13-17-15-19(18-13)14(21)11-7-10(20(22)23)4-5-12(11)24-15/h1-7,14,21H/t14-/m1/s1 |
| InChIKey | PCPFCAMWBMFVNP-CQSZACIVSA-N |
| XLogP | 3.51 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|