C71H83B2N3O4 — CID 132556178
9-[4-[bis[9-(2-ethylhexyl)carbazol-3-yl]methyl]phenyl]-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 132556178) has the molecular formula C71H83B2N3O4 and a molecular weight of 1064.09 g/mol. Its IUPAC name is 9-[4-[bis[9-(2-ethylhexyl)carbazol-3-yl]methyl]phenyl]-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-[4-[bis[9-(2-ethylhexyl)carbazol-3-yl]methyl]phenyl]-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 132556178 |
| Molecular Formula | C71H83B2N3O4 |
| Molecular Weight | 1064.09 g/mol |
| Exact Mass | 1063.66 |
| IUPAC Name | 9-[4-[bis[9-(2-ethylhexyl)carbazol-3-yl]methyl]phenyl]-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CCCCC(CC)Cn1c2ccccc2c2cc(C(c3ccc(-n4c5ccc(B6OC(C)(C)C(C)(C)O6)cc5c5cc(B6OC(C)(C)C(C)(C)O6)ccc54)cc3)c3ccc4c(c3)c3ccccc3n4CC(CC)CCCC)ccc21 |
| InChI | InChI=1S/C71H83B2N3O4/c1-13-17-23-47(15-3)45-74-61-27-21-19-25-55(61)57-41-50(31-37-63(57)74)67(51-32-38-64-58(42-51)56-26-20-22-28-62(56)75(64)46-48(16-4)24-18-14-2)49-29-35-54(36-30-49)76-65-39-33-52(72-77-68(5,6)69(7,8)78-72)43-59(65)60-44-53(34-40-66(60)76)73-79-70(9,10)71(11,12)80-73/h19-22,25-44,47-48,67H,13-18,23-24,45-46H2,1-12H3 |
| InChIKey | LFRMZAAKKDVMDJ-UHFFFAOYSA-N |
| XLogP | 17.21 |
| TPSA | 51.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1064.09 |
| LogP ≤ 5 | 17.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|