C27H25NO4 — CID 132557266
(4R)-3-[(Z,2R)-4-methoxy-2-methylbut-3-enoyl]-4,5,5-triphenyl-1,3-oxazolidin-2-one (PubChem CID 132557266) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is (4R)-3-[(Z,2R)-4-methoxy-2-methylbut-3-enoyl]-4,5,5-triphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(Z,2R)-4-methoxy-2-methylbut-3-enoyl]-4,5,5-triphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132557266 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (4R)-3-[(Z,2R)-4-methoxy-2-methylbut-3-enoyl]-4,5,5-triphenyl-1,3-oxazolidin-2-one |
| SMILES | CO/C=C\[C@@H](C)C(=O)N1C(=O)OC(c2ccccc2)(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c1-20(18-19-31-2)25(29)28-24(21-12-6-3-7-13-21)27(32-26(28)30,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-20,24H,1-2H3/b19-18-/t20-,24-/m1/s1 |
| InChIKey | GZZMDMMWFIFRBG-QKKKZYNFSA-N |
| XLogP | 5.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|