C22H21NO5 — CID 132557467
dimethyl 2-(4-methoxyphenyl)-1-phenyl-2H-pyridine-4,5-dicarboxylate (PubChem CID 132557467) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is dimethyl 2-(4-methoxyphenyl)-1-phenyl-2H-pyridine-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(4-methoxyphenyl)-1-phenyl-2H-pyridine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 132557467 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | dimethyl 2-(4-methoxyphenyl)-1-phenyl-2H-pyridine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=CC(c2ccc(OC)cc2)N(c2ccccc2)C=C1C(=O)OC |
| InChI | InChI=1S/C22H21NO5/c1-26-17-11-9-15(10-12-17)20-13-18(21(24)27-2)19(22(25)28-3)14-23(20)16-7-5-4-6-8-16/h4-14,20H,1-3H3 |
| InChIKey | APBUCSTVVYOGFA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |