C21H21N2O2P — CID 132557517
2-diphenylphosphanyl-2-(2-pyridin-2-ylethylamino)acetic acid (PubChem CID 132557517) has the molecular formula C21H21N2O2P and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-diphenylphosphanyl-2-(2-pyridin-2-ylethylamino)acetic acid.
| Compound Name | 2-diphenylphosphanyl-2-(2-pyridin-2-ylethylamino)acetic acid |
|---|---|
| PubChem CID | 132557517 |
| Molecular Formula | C21H21N2O2P |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-diphenylphosphanyl-2-(2-pyridin-2-ylethylamino)acetic acid |
| SMILES | O=C(O)C(NCCc1ccccn1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N2O2P/c24-21(25)20(23-16-14-17-9-7-8-15-22-17)26(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-13,15,20,23H,14,16H2,(H,24,25) |
| InChIKey | JKYLHOHULBXKQM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|