C24H27BrN4O2 — CID 3814783
3-(4-bromophenyl)-3-(2-pyridin-2-ylethylamino)-2-[(2-pyridin-2-ylethylamino)methyl]propanoic acid (PubChem CID 3814783) has the molecular formula C24H27BrN4O2 and a molecular weight of 483.41 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-(2-pyridin-2-ylethylamino)-2-[(2-pyridin-2-ylethylamino)methyl]propanoic acid.
| Compound Name | 3-(4-bromophenyl)-3-(2-pyridin-2-ylethylamino)-2-[(2-pyridin-2-ylethylamino)methyl]propanoic acid |
|---|---|
| PubChem CID | 3814783 |
| Molecular Formula | C24H27BrN4O2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-(4-bromophenyl)-3-(2-pyridin-2-ylethylamino)-2-[(2-pyridin-2-ylethylamino)methyl]propanoic acid |
| SMILES | O=C(O)C(CNCCc1ccccn1)C(NCCc1ccccn1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H27BrN4O2/c25-19-9-7-18(8-10-19)23(29-16-12-21-6-2-4-14-28-21)22(24(30)31)17-26-15-11-20-5-1-3-13-27-20/h1-10,13-14,22-23,26,29H,11-12,15-17H2,(H,30,31) |
| InChIKey | QZXMIQYJOHCVQE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|