C20H20O6 — CID 132561205
(1R,8S,9R,10S)-9-(7-hydroxy-1,3-benzodioxol-5-yl)-10-methyl-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one (PubChem CID 132561205) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (1R,8S,9R,10S)-9-(7-hydroxy-1,3-benzodioxol-5-yl)-10-methyl-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one.
| Compound Name | (1R,8S,9R,10S)-9-(7-hydroxy-1,3-benzodioxol-5-yl)-10-methyl-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one |
|---|---|
| PubChem CID | 132561205 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (1R,8S,9R,10S)-9-(7-hydroxy-1,3-benzodioxol-5-yl)-10-methyl-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one |
| SMILES | C=CC[C@@]12C[C@@]3(OCOC3=CC1=O)[C@@H](C)[C@@H]2c1cc(O)c2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O6/c1-3-4-19-8-20(16(7-15(19)22)24-10-26-20)11(2)17(19)12-5-13(21)18-14(6-12)23-9-25-18/h3,5-7,11,17,21H,1,4,8-10H2,2H3/t11-,17+,19+,20+/m0/s1 |
| InChIKey | VDUSKXGWUNCQNY-GUDLYQINSA-N |
| XLogP | 3.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|