C26H30O7 — CID 101064063
(1S,8S,9S)-9-(2-hydroxypropan-2-yl)-11-(5-methoxy-6-prop-2-enyl-1,3-benzodioxol-2-yl)-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one (PubChem CID 101064063) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is (1S,8S,9S)-9-(2-hydroxypropan-2-yl)-11-(5-methoxy-6-prop-2-enyl-1,3-benzodioxol-2-yl)-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one.
| Compound Name | (1S,8S,9S)-9-(2-hydroxypropan-2-yl)-11-(5-methoxy-6-prop-2-enyl-1,3-benzodioxol-2-yl)-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one |
|---|---|
| PubChem CID | 101064063 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (1S,8S,9S)-9-(2-hydroxypropan-2-yl)-11-(5-methoxy-6-prop-2-enyl-1,3-benzodioxol-2-yl)-8-prop-2-enyl-2,4-dioxatricyclo[6.2.1.01,5]undec-5-en-7-one |
| SMILES | C=CCc1cc2c(cc1OC)OC(C1[C@@]34C[C@H](C(C)(C)O)[C@]1(CC=C)C(=O)C=C3OCO4)O2 |
| InChI | InChI=1S/C26H30O7/c1-6-8-15-10-17-18(11-16(15)29-5)33-23(32-17)22-25(9-7-2)19(24(3,4)28)13-26(22)21(12-20(25)27)30-14-31-26/h6-7,10-12,19,22-23,28H,1-2,8-9,13-14H2,3-5H3/t19-,22?,23?,25-,26-/m1/s1 |
| InChIKey | LWEDIQNSOBIAMP-RDCQHXETSA-N |
| XLogP | 3.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|