C20H24N2O4 — CID 132561609
(1S,3S,16R,17R)-17-ethyl-9-methoxy-5,15-diazatetracyclo[13.3.1.03,16.06,11]nonadeca-6(11),7,9-triene-4,12,19-trione (PubChem CID 132561609) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1S,3S,16R,17R)-17-ethyl-9-methoxy-5,15-diazatetracyclo[13.3.1.03,16.06,11]nonadeca-6(11),7,9-triene-4,12,19-trione.
| Compound Name | (1S,3S,16R,17R)-17-ethyl-9-methoxy-5,15-diazatetracyclo[13.3.1.03,16.06,11]nonadeca-6(11),7,9-triene-4,12,19-trione |
|---|---|
| PubChem CID | 132561609 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (1S,3S,16R,17R)-17-ethyl-9-methoxy-5,15-diazatetracyclo[13.3.1.03,16.06,11]nonadeca-6(11),7,9-triene-4,12,19-trione |
| SMILES | CC[C@@H]1C[C@H]2C[C@@H]3C(=O)Nc4ccc(OC)cc4C(=O)CCN(C2=O)[C@H]13 |
| InChI | InChI=1S/C20H24N2O4/c1-3-11-8-12-9-15-18(11)22(20(12)25)7-6-17(23)14-10-13(26-2)4-5-16(14)21-19(15)24/h4-5,10-12,15,18H,3,6-9H2,1-2H3,(H,21,24)/t11-,12+,15+,18-/m1/s1 |
| InChIKey | TVNCKXNZCDXVKS-SJECXTJVSA-N |
| XLogP | 2.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |