C17H18FNO2 — CID 132565965
(3-fluoro-6-methoxyquinolin-4-yl)-(1-methyl-2-methylidenecyclobutyl)methanol (PubChem CID 132565965) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is (3-fluoro-6-methoxyquinolin-4-yl)-(1-methyl-2-methylidenecyclobutyl)methanol.
| Compound Name | (3-fluoro-6-methoxyquinolin-4-yl)-(1-methyl-2-methylidenecyclobutyl)methanol |
|---|---|
| PubChem CID | 132565965 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3-fluoro-6-methoxyquinolin-4-yl)-(1-methyl-2-methylidenecyclobutyl)methanol |
| SMILES | C=C1CCC1(C)C(O)c1c(F)cnc2ccc(OC)cc12 |
| InChI | InChI=1S/C17H18FNO2/c1-10-6-7-17(10,2)16(20)15-12-8-11(21-3)4-5-14(12)19-9-13(15)18/h4-5,8-9,16,20H,1,6-7H2,2-3H3 |
| InChIKey | YXDUSJAHWIEKRL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|