C18H16O3 — CID 132571546
methyl 9-methyl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-14-carboxylate (PubChem CID 132571546) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 9-methyl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-14-carboxylate.
| Compound Name | methyl 9-methyl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 132571546 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 9-methyl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,12,14-hexaene-14-carboxylate |
| SMILES | COC(=O)c1cc2c3c(c1)-c1ccccc1CC3(C)CO2 |
| InChI | InChI=1S/C18H16O3/c1-18-9-11-5-3-4-6-13(11)14-7-12(17(19)20-2)8-15(16(14)18)21-10-18/h3-8H,9-10H2,1-2H3 |
| InChIKey | BLXYWEPDCNAFDQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |