C22H22ClNO3 — CID 132572928
(5S,8R,10R)-7-benzyl-10-(4-chlorophenyl)-8-hydroxy-7-azaspiro[4.5]decane-4,6-dione (PubChem CID 132572928) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is (5S,8R,10R)-7-benzyl-10-(4-chlorophenyl)-8-hydroxy-7-azaspiro[4.5]decane-4,6-dione.
| Compound Name | (5S,8R,10R)-7-benzyl-10-(4-chlorophenyl)-8-hydroxy-7-azaspiro[4.5]decane-4,6-dione |
|---|---|
| PubChem CID | 132572928 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (5S,8R,10R)-7-benzyl-10-(4-chlorophenyl)-8-hydroxy-7-azaspiro[4.5]decane-4,6-dione |
| SMILES | O=C1CCC[C@@]12C(=O)N(Cc1ccccc1)[C@H](O)C[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO3/c23-17-10-8-16(9-11-17)18-13-20(26)24(14-15-5-2-1-3-6-15)21(27)22(18)12-4-7-19(22)25/h1-3,5-6,8-11,18,20,26H,4,7,12-14H2/t18-,20-,22+/m1/s1 |
| InChIKey | BXCXMHOEBIPYFS-UZKOGDIHSA-N |
| XLogP | 3.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|