C22H24BrNO6 — CID 132573396
3-O,4-O-diethyl 2-O-methyl (2R,3R,4S,5S)-5-(1-bromonaphthalen-2-yl)pyrrolidine-2,3,4-tricarboxylate (PubChem CID 132573396) has the molecular formula C22H24BrNO6 and a molecular weight of 478.34 g/mol. Its IUPAC name is 3-O,4-O-diethyl 2-O-methyl (2R,3R,4S,5S)-5-(1-bromonaphthalen-2-yl)pyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-diethyl 2-O-methyl (2R,3R,4S,5S)-5-(1-bromonaphthalen-2-yl)pyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 132573396 |
| Molecular Formula | C22H24BrNO6 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-O,4-O-diethyl 2-O-methyl (2R,3R,4S,5S)-5-(1-bromonaphthalen-2-yl)pyrrolidine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(=O)OCC)[C@@H](c2ccc3ccccc3c2Br)N[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H24BrNO6/c1-4-29-20(25)15-16(21(26)30-5-2)19(22(27)28-3)24-18(15)14-11-10-12-8-6-7-9-13(12)17(14)23/h6-11,15-16,18-19,24H,4-5H2,1-3H3/t15-,16+,18+,19+/m0/s1 |
| InChIKey | POZPXEMTIUIYBW-QFHJOOASSA-N |
| XLogP | 3.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|