C16H21F3O4 — CID 132579780
ethyl 4,4,4-trifluoro-3,3-bis(pent-2-ynoxy)butanoate (PubChem CID 132579780) has the molecular formula C16H21F3O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3,3-bis(pent-2-ynoxy)butanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3,3-bis(pent-2-ynoxy)butanoate |
|---|---|
| PubChem CID | 132579780 |
| Molecular Formula | C16H21F3O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3,3-bis(pent-2-ynoxy)butanoate |
| SMILES | CCC#CCOC(CC(=O)OCC)(OCC#CCC)C(F)(F)F |
| InChI | InChI=1S/C16H21F3O4/c1-4-7-9-11-22-15(16(17,18)19,13-14(20)21-6-3)23-12-10-8-5-2/h4-6,11-13H2,1-3H3 |
| InChIKey | BGRLHQRTZNFRNY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|