C18H15NO4 — CID 132582403
N-[(6R)-8-oxo-6,7-dihydro-5H-benzo[f][1,3]benzodioxol-6-yl]benzamide (PubChem CID 132582403) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[(6R)-8-oxo-6,7-dihydro-5H-benzo[f][1,3]benzodioxol-6-yl]benzamide.
| Compound Name | N-[(6R)-8-oxo-6,7-dihydro-5H-benzo[f][1,3]benzodioxol-6-yl]benzamide |
|---|---|
| PubChem CID | 132582403 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[(6R)-8-oxo-6,7-dihydro-5H-benzo[f][1,3]benzodioxol-6-yl]benzamide |
| SMILES | O=C(N[C@H]1CC(=O)c2cc3c(cc2C1)OCO3)c1ccccc1 |
| InChI | InChI=1S/C18H15NO4/c20-15-8-13(19-18(21)11-4-2-1-3-5-11)6-12-7-16-17(9-14(12)15)23-10-22-16/h1-5,7,9,13H,6,8,10H2,(H,19,21)/t13-/m1/s1 |
| InChIKey | MOOCRVRCHAESII-CYBMUJFWSA-N |
| XLogP | 2.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |