C11H15F3N2O2 — CID 132586250
ethyl 3-(3,5-dimethylpyrazol-1-yl)-4,4,4-trifluorobutanoate (PubChem CID 132586250) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is ethyl 3-(3,5-dimethylpyrazol-1-yl)-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 3-(3,5-dimethylpyrazol-1-yl)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 132586250 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethyl 3-(3,5-dimethylpyrazol-1-yl)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(n1nc(C)cc1C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O2/c1-4-18-10(17)6-9(11(12,13)14)16-8(3)5-7(2)15-16/h5,9H,4,6H2,1-3H3 |
| InChIKey | XNJCXTSXEQJGTQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |