C25H28N2O5 — CID 132591771
1-(3,4-dimethoxyphenyl)-3-(4-ethylphenyl)-3-(3-nitroanilino)propan-1-ol (PubChem CID 132591771) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(4-ethylphenyl)-3-(3-nitroanilino)propan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(4-ethylphenyl)-3-(3-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 132591771 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(4-ethylphenyl)-3-(3-nitroanilino)propan-1-ol |
| SMILES | CCc1ccc(C(CC(O)c2ccc(OC)c(OC)c2)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-4-17-8-10-18(11-9-17)22(26-20-6-5-7-21(15-20)27(29)30)16-23(28)19-12-13-24(31-2)25(14-19)32-3/h5-15,22-23,26,28H,4,16H2,1-3H3 |
| InChIKey | MLPVTDLPDKMBGP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|