C30H16F12N2 — CID 132595321
4,7-bis[3,5-bis(trifluoromethyl)phenyl]-2,9-dimethyl-1,10-phenanthroline (PubChem CID 132595321) has the molecular formula C30H16F12N2 and a molecular weight of 632.45 g/mol. Its IUPAC name is 4,7-bis[3,5-bis(trifluoromethyl)phenyl]-2,9-dimethyl-1,10-phenanthroline.
| Compound Name | 4,7-bis[3,5-bis(trifluoromethyl)phenyl]-2,9-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 132595321 |
| Molecular Formula | C30H16F12N2 |
| Molecular Weight | 632.45 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 4,7-bis[3,5-bis(trifluoromethyl)phenyl]-2,9-dimethyl-1,10-phenanthroline |
| SMILES | Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc3c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C30H16F12N2/c1-13-5-23(15-7-17(27(31,32)33)11-18(8-15)28(34,35)36)21-3-4-22-24(6-14(2)44-26(22)25(21)43-13)16-9-19(29(37,38)39)12-20(10-16)30(40,41)42/h3-12H,1-2H3 |
| InChIKey | QZMHZYOXUMKALC-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.45 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|