About 2-quinolin-2-ylquinoline
2-quinolin-2-ylquinoline (PubChem CID 8412) has the molecular formula C18H12N2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-quinolin-2-ylquinoline.
Molecular Properties
| Compound Name | 2-quinolin-2-ylquinoline |
| PubChem CID | 8412 |
| Molecular Formula | C18H12N2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-quinolin-2-ylquinoline |
| SMILES | c1ccc2nc(-c3ccc4ccccc4n3)ccc2c1 |
| InChI | InChI=1S/C18H12N2/c1-3-7-15-13(5-1)9-11-17(19-15)18-12-10-14-6-2-4-8-16(14)20-18/h1-12H |
| InChIKey | WPTCSQBWLUUYDV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-quinolin-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-2-ylquinoline?
The IUPAC name of 2-quinolin-2-ylquinoline (CID 8412) is 2-quinolin-2-ylquinoline.
What is the SMILES notation for 2-quinolin-2-ylquinoline?
The canonical SMILES for 2-quinolin-2-ylquinoline is c1ccc2nc(-c3ccc4ccccc4n3)ccc2c1.
What is the InChIKey of 2-quinolin-2-ylquinoline?
The InChIKey is WPTCSQBWLUUYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2/c1-3-7-15-13(5-1)9-11-17(19-15)18-12-10-14-6-2-4-8-16(14)20-18/h1-12H.
What are the key properties of 2-quinolin-2-ylquinoline?
2-quinolin-2-ylquinoline has a molecular weight of 256.31 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-2-ylquinoline is sourced from PubChem (CID 8412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).