C20H21F3O6 — CID 132597871
methyl (2S,3S,4R)-2-hydroxy-4-(4-hydroxyphenyl)-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate (PubChem CID 132597871) has the molecular formula C20H21F3O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is methyl (2S,3S,4R)-2-hydroxy-4-(4-hydroxyphenyl)-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate.
| Compound Name | methyl (2S,3S,4R)-2-hydroxy-4-(4-hydroxyphenyl)-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 132597871 |
| Molecular Formula | C20H21F3O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl (2S,3S,4R)-2-hydroxy-4-(4-hydroxyphenyl)-7,7-dimethyl-5-oxo-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccc(O)cc2)C2=C(CC(C)(C)CC2=O)O[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C20H21F3O6/c1-18(2)8-12(25)15-13(9-18)29-19(27,20(21,22)23)16(17(26)28-3)14(15)10-4-6-11(24)7-5-10/h4-7,14,16,24,27H,8-9H2,1-3H3/t14-,16-,19+/m1/s1 |
| InChIKey | BJLKQPGXFBDNNA-OGWOLHLISA-N |
| XLogP | 3.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |