C28H27NO3 — CID 132600625
methyl (2S,3S)-2-(1-methylindol-3-yl)-3-(3-methylphenyl)-5-oxo-2-phenylpentanoate (PubChem CID 132600625) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is methyl (2S,3S)-2-(1-methylindol-3-yl)-3-(3-methylphenyl)-5-oxo-2-phenylpentanoate.
| Compound Name | methyl (2S,3S)-2-(1-methylindol-3-yl)-3-(3-methylphenyl)-5-oxo-2-phenylpentanoate |
|---|---|
| PubChem CID | 132600625 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | methyl (2S,3S)-2-(1-methylindol-3-yl)-3-(3-methylphenyl)-5-oxo-2-phenylpentanoate |
| SMILES | COC(=O)[C@@](c1ccccc1)(c1cn(C)c2ccccc12)[C@@H](CC=O)c1cccc(C)c1 |
| InChI | InChI=1S/C28H27NO3/c1-20-10-9-11-21(18-20)24(16-17-30)28(27(31)32-3,22-12-5-4-6-13-22)25-19-29(2)26-15-8-7-14-23(25)26/h4-15,17-19,24H,16H2,1-3H3/t24-,28+/m0/s1 |
| InChIKey | PLIGWSVFLZXNTI-RBJSKKJNSA-N |
| XLogP | 5.32 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|